CAS 150828-96-9

N(alpha)-boc-N(delta)-fmoc-L-ornithine

Description:

N(alpha)-Boc-N(delta)-Fmoc-L-ornithine is a protected amino acid derivative commonly used in peptide synthesis and research. It features two protective groups: the Boc (tert-butyloxycarbonyl) group at the alpha-amino position and the Fmoc (9-fluorenylmethoxycarbonyl) group at the side-chain amino group. These protective groups facilitate the selective functionalization of the amino acid during peptide synthesis, allowing for the formation of complex peptides while preventing unwanted reactions. The compound is typically a white to off-white solid and is soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its structure includes a primary amine, which can participate in further reactions, making it versatile in synthetic applications. The presence of the ornithine backbone contributes to its role in the synthesis of peptides that may have biological significance, particularly in the context of drug development and biochemistry. Proper handling and storage are essential due to its reactivity and the potential hazards associated with its protective groups.

Formula: C₂₅H₃₀N₂O₆

InChI: InChI=1/C25H30N2O6/c1-25(2,3)33-24(31)27-21(22(28)29)13-8-14-26-23(30)32-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20-21H,8,13-15H2,1-3H3,(H,26,30)(H,27,31)(H,28,29)/t21-/m0/s1

SMILES: CC(C)(C)OC(=N[C@@H](CCCN=C(O)OCC1c2ccccc2c2ccccc12)C(=O)O)O

Synonyms:

• Boc-Orn(Fmoc)-OH
• N2-(tert-butoxycarbonyl)-N5-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine

Boc-Orn(Fmoc)-OH

CAS: 150828-96-9

Bachem ID: 4017884.

Formula: C₂₅H₃₀N₂O₆

Purity: 99.2%

Color and Shape: White

Molecular weight: 454.52

Ref: 01-4017884

L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[(9H-fluoren-9-ylmethoxy)carbonyl]-

CAS: 150828-96-9

Formula: C₂₅H₃₀N₂O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 454.5155

Ref: IN-DA001MVL

Boc-Orn(Fmoc)-OH

CAS: 150828-96-9

Boc-Orn(Fmoc)-OH

Purity: 98%

Molecular weight: 454.52g/mol

Ref: 54-OR1012539

Boc-Orn(Fmoc)-OH

CAS: 150828-96-9

Molecular weight: 454.52

Ref: 7W-GM9200

boc-orn(fmoc)-oh

CAS: 150828-96-9

Formula: C₂₅H₃₀N₂O₆

Purity: 95%

Color and Shape: Solid, White to off-white powder

Molecular weight: 454.523

Ref: 10-F045437