CAS 1509-92-8: N-acetyl-D-methionine
Description:N-acetyl-D-methionine is a derivative of the amino acid methionine, characterized by the addition of an acetyl group to the nitrogen atom of the amino group. This modification enhances its solubility and stability compared to its parent compound. It is a white to off-white crystalline powder, typically soluble in water and organic solvents, making it useful in various biochemical applications. N-acetyl-D-methionine plays a role in metabolic processes and is often studied for its potential antioxidant properties, as it may help in reducing oxidative stress in biological systems. Additionally, it is involved in the synthesis of other important biomolecules and may have implications in nutritional and therapeutic contexts. Its CAS number, 1509-92-8, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, N-acetyl-D-methionine is a significant compound in both research and potential clinical applications, particularly in the fields of nutrition and pharmacology.
Formula:C7H13NO3S
InChI:InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m1/s1
InChI key:InChIKey=XUYPXLNMDZIRQH-ZCFIWIBFSA-N
SMILES:O=C(O)C(NC(=O)C)CCSC
- Synonyms:
- <span class="text-smallcaps">D</span>-Methionine, N-acetyl-
- Ac-D-Met-OH
- Methionine, N-acetyl-, <span class="text-smallcaps">D</span>-
- N-Acetyl-<span class="text-smallcaps">D</span>-methionine
