CAS 15090-23-0
:3-Methylphosphinicopropionic acid
Description:
3-Methylphosphinicopropionic acid, with the CAS number 15090-23-0, is an organophosphorus compound characterized by the presence of a phosphinic acid functional group. This compound features a three-carbon propionic acid backbone with a methyl group attached to the second carbon, which contributes to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the phosphinic group imparts specific reactivity, making it of interest in various chemical applications, including as a potential herbicide or in the synthesis of other organophosphorus compounds. Its solubility in water and organic solvents can vary, influencing its utility in different chemical environments. Additionally, 3-Methylphosphinicopropionic acid may exhibit biological activity, which warrants careful handling and consideration of safety protocols during its use in laboratory or industrial settings. Overall, its structural features and functional groups make it a compound of interest in both research and practical applications in chemistry.
Formula:C4H9O4P
InChI:InChI=1S/C4H9O4P/c1-9(7,8)3-2-4(5)6/h2-3H2,1H3,(H,5,6)(H,7,8)
InChI key:InChIKey=QXFUBAAEKCHBQY-UHFFFAOYSA-N
SMILES:C(P(C)(=O)O)CC(O)=O
Synonyms:- (2-Carboxyethyl)methylphosphinic acid
- 3-(Hydroxymethylphosphinyl)propanoic acid
- 3-(Hydroxymethylphosphinyl)propionic acid
- 3-Methylphosphinicopropionic Acid
- 3-[Hydroxy(Methyl)Phosphoryl]Propanoic Acid
- Methylphosphinicopropionic acid
- Propanoic acid, 3-(hydroxymethylphosphinyl)-
- Propionic acid, 3-(hydroxymethylphosphinyl)-
- β-Carboxyethylmethylphosphinic acid
- MPPA
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-[hydroxy(methyl)phosphoryl]propanoic acid
CAS:Formula:C4H9O4PColor and Shape:SolidMolecular weight:152.08563-Methylphosphinicopropionic acid 100 µg/mL in Acetonitrile
CAS:Formula:C4H9O4PColor and Shape:Single SolutionMolecular weight:152.093-(Methylphosphinico)propionic acid
CAS:<p>3-(Methylphosphinico)propionic acid (3-MPPA) is a metabolite of glyphosate and has been detected in urine samples. It was found to be resistant to enzymatic hydrolysis and the formation of 3-MPPA is catalyzed by trimethyl phosphine, a reaction that can be inhibited by ammonium formate. The presence of 3-MPPA in urine has been correlated with exposure to glyphosate, which is commonly used as an herbicide on crops. 3-MPPA also reacts with trifluoroacetic acid to produce trimethyl phosphine gas, which can be detected using spectrometers. 3-MPPA has been shown to inhibit the growth of bacteria by inhibiting the synthesis of DNA and RNA.</p>Formula:C4H9O4PPurity:Min. 98.0%Color and Shape:PowderMolecular weight:152.09 g/mol



