CAS 150907-43-0
:3-(3-(ethoxycarbonyl)propionyl)-8-methoxy-4-((2-methylphenyl)amino)quinoline
Description:
3-(3-(ethoxycarbonyl)propionyl)-8-methoxy-4-((2-methylphenyl)amino)quinoline, with the CAS number 150907-43-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core substituted with various functional groups. The presence of an ethoxycarbonyl group suggests it has ester characteristics, while the methoxy group indicates potential for increased lipophilicity. The 2-methylphenylamino substitution enhances its potential for biological activity, possibly influencing its interaction with biological targets. This compound may exhibit properties such as fluorescence or photostability due to the quinoline moiety, which is known for its applications in pharmaceuticals and dyes. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities, solubility, and stability would require empirical investigation to fully characterize its behavior in various environments. Overall, this compound represents a class of quinoline derivatives that may hold promise in drug discovery and development.
Formula:C23H24N2O4
InChI:InChI=1/C23H24N2O4/c1-4-29-21(27)13-12-19(26)17-14-24-23-16(9-7-11-20(23)28-3)22(17)25-18-10-6-5-8-15(18)2/h5-11,14H,4,12-13H2,1-3H3,(H,24,25)
Synonyms:- ethyl 4-{8-methoxy-4-[(2-methylphenyl)amino]quinolin-3-yl}-4-oxobutanoate
- 3-(3-(Ethoxycarbonyl)propionyl)-8-methoxy-4-((2-methylphenyl)amino)quinoline
- CP 113411
- CP 113,411
- 3-Quinolinebutanoic acid, 8-methoxy-4-((2-methylphenyl)amino)-gamma-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Quinolinebutanoic acid, 8-methoxy-4-[(2-methylphenyl)amino]-γ-oxo-, ethyl ester
CAS:Formula:C23H24N2O4Molecular weight:392.4477
