CAS 15097-38-8
:benzyl (triphenylphosphoranylidene)-acetate
Description:
Benzyl (triphenylphosphoranylidene)-acetate, with the CAS number 15097-38-8, is an organic compound characterized by the presence of a phosphoranylidene group attached to a benzyl acetate moiety. This compound typically exhibits a white to light yellow crystalline appearance. It is known for its role in organic synthesis, particularly in reactions involving phosphoranylidene derivatives, which can act as intermediates in various chemical transformations. The presence of the triphenylphosphoranylidene moiety contributes to its reactivity, making it useful in the formation of new carbon-carbon bonds. Additionally, the compound may exhibit moderate solubility in organic solvents, such as dichloromethane or ethyl acetate, while being less soluble in polar solvents. Its stability under standard laboratory conditions allows for its use in various synthetic applications. As with many organophosphorus compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, benzyl (triphenylphosphoranylidene)-acetate is a valuable compound in the field of organic chemistry.
Formula:C27H23O2P
InChI:InChI=1/C27H23O2P/c28-27(29-21-23-13-5-1-6-14-23)22-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,22H,21H2
SMILES:c1ccc(cc1)COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1
Synonyms:- Benzyl (Triphenyl-Lambda~5~-Phosphanylidene)Acetate
- Benzyl (triphenylphosphoranylidene)acetate
- Acetic acid,2-(triphenylphosphoranylidene)-, phenylMethyl ester
- Benzyl 2-(triphenylphosphoranylidene)acetate
- Benzyl(triphenylphosphoranylidene)acetate 97%
- Benzyl (triphenylphosphoranylidene)acetate, 97 %
- LABOTEST-BB LT00452383
- 2-(Triphenylphosphoranylidene)acetic acid phenylmethyl ester
- (BenzyloxycarbonylMethylene)triphenylphosphorane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Acetic acid, 2-(triphenylphosphoranylidene)-, phenylmethyl ester
CAS:Formula:C27H23O2PPurity:97%Color and Shape:SolidMolecular weight:410.4441Benzyl 2-(triphenylphosphoranylidene)acetate
CAS:Benzyl 2-(triphenylphosphoranylidene)acetatePurity:98%Molecular weight:410.45g/molBenzyl (Triphenylphosphoranylidene)acetate
CAS:Benzyl (Triphenylphosphoranylidene)acetatePurity:98%Molecular weight:410.45g/molBenzyl (Triphenylphosphoranylidene)acetate
CAS:Formula:C27H23O2PPurity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:410.45Benzyl(triphenylphosphoranylidene)acetate
CAS:Formula:C27H23O2PPurity:98%Color and Shape:SolidMolecular weight:410.453Benzyl 2-(triphenylphosphoranylidene)acetate
CAS:Versatile small molecule scaffoldFormula:C27H23O2PPurity:Min. 95%Molecular weight:410.44 g/mol




