CAS 1510-04-9
:Glycyl-L-phenylalaninamide
Description:
Glycyl-L-phenylalaninamide, with the CAS number 1510-04-9, is a dipeptide derivative formed from the amino acids glycine and L-phenylalanine. This compound exhibits characteristics typical of peptides, including the ability to participate in hydrogen bonding due to the presence of amide linkages. It is generally soluble in polar solvents, such as water, owing to its amino acid composition. Glycyl-L-phenylalaninamide may exhibit biological activity, potentially influencing various physiological processes, although specific pharmacological effects can vary. The presence of the phenylalanine side chain may contribute to its interactions with biological receptors or enzymes. Additionally, this compound can be utilized in biochemical research and may serve as a building block for more complex peptide synthesis. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Glycyl-L-phenylalaninamide represents a significant structure in the study of peptides and their functions in biological systems.
Formula:C11H15N3O2
InChI:InChI=1S/C11H15N3O2/c12-7-10(15)14-9(11(13)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H2,13,16)(H,14,15)/t9-/m0/s1
InChI key:InChIKey=PSPZOKPNYCSKSW-VIFPVBQESA-N
SMILES:[C@@H](CC1=CC=CC=C1)(NC(CN)=O)C(N)=O
Synonyms:- L-Phenylalaninamide, glycyl-
- Alaninamide, glycylphenyl-, L-
- Glycyl-L-phenylalaninamide
- Hydrocinnamamide, α-(2-aminoacetamido)-, L-
- Glycyl-L-phenylalanine amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
