CAS 151006-14-3: PRAVASTATIN 1,1,3,3-TETRAMETHYL BUTYLAMINE
Description:Pravastatin 1,1,3,3-Tetramethyl Butylamine, identified by the CAS number 151006-14-3, is a chemical compound that belongs to the class of statins, which are primarily used to lower cholesterol levels in the blood. This compound features a butylamine structure with four methyl groups attached, contributing to its unique properties. Statins function by inhibiting the enzyme HMG-CoA reductase, which plays a crucial role in cholesterol biosynthesis. The presence of the tetramethyl group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. Pravastatin is known for its relatively low potential for drug-drug interactions compared to other statins, making it a preferred choice in certain patient populations. Additionally, it exhibits anti-inflammatory properties and may have beneficial effects on cardiovascular health beyond cholesterol reduction. As with all medications, the use of pravastatin should be guided by a healthcare professional, considering individual patient factors and potential side effects.
Formula:C31H55NO7
InChI:InChI=1/C23H36O7.C8H19N/c1-4-13(2)23(29)30-20-11-17(25)9-15-6-5-14(3)19(22(15)20)8-7-16(24)10-18(26)12-21(27)28;1-7(2,3)6-8(4,5)9/h5-6,9,13-14,16-20,22,24-26H,4,7-8,10-12H2,1-3H3,(H,27,28);6,9H2,1-5H3/t13-,14-,16+,17+,18+,19-,20-,22-;/m0./s1
- Synonyms:
- [1S-[1a(S*,dS*),2a,6a,8(R*),8aa]]-1,2,6,7,8,8a-Hexahydro-,d,6-trihydroxy-2-methyl-8-(2-methyl-1-oxobutoxy)-1-naphthaleneheptanoate 2,4,4-Trimethyl-2-pentanamine