CymitQuimica logo

CAS 151021-42-0

:

Propanedinitrile, 2,2′-[1,4-piperazinediylbis[(5-cyano-6-ethoxy-4-phenyl-2,3-pyridinediyl)methylidyne]]bis-

Description:
Propanedinitrile, 2,2′-[1,4-piperazinediylbis[(5-cyano-6-ethoxy-4-phenyl-2,3-pyridinediyl)methylidyne]]bis- is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as nitriles and piperazine moieties. The presence of cyano groups contributes to its potential reactivity and ability to participate in various chemical reactions, while the ethoxy and phenyl substituents enhance its solubility and stability in organic solvents. This compound is likely to exhibit significant biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its synthesis may involve multi-step organic reactions, and it is essential to handle it with care due to potential toxicity associated with nitrile compounds. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and overall molecular architecture. As with many complex organic compounds, further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C40H30N10O2
InChI:InChI=1S/C40H30N10O2/c1-3-51-39-33(25-45)35(29-11-7-5-8-12-29)31(19-27(21-41)22-42)37(47-39)49-15-17-50(18-16-49)38-32(20-28(23-43)24-44)36(30-13-9-6-10-14-30)34(26-46)40(48-38)52-4-2/h5-14,19-20H,3-4,15-18H2,1-2H3
InChI key:InChIKey=STJSIGWPROOGEU-UHFFFAOYSA-N
SMILES:C(=C(C#N)C#N)C=1C(=C(C#N)C(OCC)=NC1N2CCN(CC2)C3=C(C=C(C#N)C#N)C(=C(C#N)C(OCC)=N3)C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:
  • Propanedinitrile, 2,2′-[1,4-piperazinediylbis[(5-cyano-6-ethoxy-4-phenyl-2,3-pyridinediyl)methylidyne]]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.