CAS 151049-87-5

1H-Pyrazole, 3-bromo-1-methyl-

Description:

1H-Pyrazole, 3-bromo-1-methyl- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 3-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the electron-withdrawing nature of the bromine atom. The compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its solubility in organic solvents and moderate stability under standard conditions are notable characteristics. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 1H-Pyrazole, 3-bromo-1-methyl- serves as a valuable building block in synthetic organic chemistry and research.

Formula: C₄H₅BrN₂

InChI: InChI=1/C4H5BrN2/c1-7-3-2-4(5)6-7/h2-3H,1H3

SMILES: Cn1ccc(Br)n1

Synonyms:

• 3-Bromo-1-methylpyrazole
• 3-bromo-1-methyl-1H-pyrazole

1H-Pyrazole, 3-bromo-1-methyl-

CAS: 151049-87-5

Formula: C₄H₅BrN₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 160.9999

Ref: IN-DA001N1Z

3-Bromo-1-methyl-1H-pyrazole

CAS: 151049-87-5

3-Bromo-1-methyl-1H-pyrazole

Purity: 97%

Molecular weight: 161.00g/mol

Ref: 54-OR903550

3-Bromo-1-methylpyrazole

CAS: 151049-87-5

Formula: C₄H₅BrN₂

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 161.002

Ref: 10-F093190