CAS 151096-42-3

2-Bromo-3,4,5,6-tetrafluorobenzoylchloride

Description:

2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride is an organofluorine compound characterized by the presence of both bromine and multiple fluorine substituents on a benzoyl chloride structure. This compound features a benzene ring with four fluorine atoms and one bromine atom attached to the carbon atoms, along with a carbonyl group (C=O) and a chlorine atom, which contributes to its reactivity. The presence of electronegative fluorine atoms significantly influences its chemical properties, enhancing its polarity and making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit high stability under certain conditions, although it can be reactive towards nucleophiles due to the electrophilic nature of the carbonyl carbon and the presence of the acyl chloride functional group. Safety precautions are necessary when handling this substance, as it may be harmful and can release toxic fumes upon decomposition.

Formula: C₇BrClF₄O

InChI: InChI=1/C7BrClF4O/c8-2-1(7(9)14)3(10)5(12)6(13)4(2)11

SMILES: c1(c(c(c(c(c1F)F)F)F)Br)C(=O)Cl

Synonyms:

• 2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride

2-bromo-3,4,5,6-tetrafluorobenzoyl chloride

CAS: 151096-42-3

Formula: C₇BrClF₄O

Molecular weight: 291.4249

Ref: IN-DA001N36

2-bromo-3,4,5,6-tetrafluorobenzoyl chloride

CAS: 151096-42-3

2-bromo-3,4,5,6-tetrafluorobenzoyl chloride

Purity: ≥95%

Molecular weight: 291.42g/mol

Ref: 54-PC10511