CAS 15112-62-6

3-Iodo-2-methylpyridine

Description:

3-Iodo-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with an iodine atom at the 3-position and a methyl group at the 2-position. Its molecular formula is C7H8N I, indicating the presence of carbon, hydrogen, nitrogen, and iodine. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its aromatic properties due to the presence of the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis. 3-Iodo-2-methylpyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the iodine atom can enhance its reactivity and influence its physical properties, such as solubility in organic solvents. Safety precautions should be taken when handling this compound, as iodine can be hazardous, and proper storage conditions are essential to maintain its stability.

Formula: C₆H₆IN

InChI: InChI=1/C6H6IN/c1-5-6(7)3-2-4-8-5/h2-4H,1H3

SMILES: Cc1c(cccn1)I

Synonyms:

• Pyridine, 3-iodo-2-methyl-
• 3-IODO-2-METHYLPYRIDINE

Pyridine, 3-iodo-2-methyl-

CAS: 15112-62-6

Formula: C₆H₆IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.0230

Ref: IN-DA001N43

3-Iodo-2-methylpyridine

CAS: 15112-62-6

3-Iodo-2-methylpyridine

Purity: 95%

Molecular weight: 219.02g/mol

Ref: 54-OR345263

3-Iodo-2-methylpyridine

CAS: 15112-62-6

Formula: C₆H₆IN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 219.025

Ref: 10-F227860

3-Iodo-2-methylpyridine

CAS: 15112-62-6

3-Iodo-2-methylpyridine is a fluorescent probe that is used to measure mitochondrial membrane potential in muscle cells. It has been shown to be effective in the treatment of autoimmune diseases and HIV infection. 3-Iodo-2-methylpyridine is soluble in water, alcohols, ethers, and chloroform. This compound has a liquid crystal composition and can form crystals with different morphologies upon cooling. 3-Iodo-2-methylpyridine has been used as an optical probe for the detection of silicon in biological samples. The hydroxy group on this molecule makes it active against nitro groups.

Formula: C₆H₆IN

Purity: Min. 95%

Color and Shape: Yellow Powder

Molecular weight: 219.02 g/mol

Ref: 3D-FI55698