CAS 151132-82-0
:(2S)-2-(benzyloxycarbonylamino)-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid
Description:
The chemical substance known as (2S)-2-(benzyloxycarbonylamino)-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid, with CAS number 151132-82-0, is a synthetic amino acid derivative. It features a chiral center, indicating that it exists in two enantiomeric forms, with the (2S) configuration being biologically relevant. This compound is characterized by the presence of multiple functional groups, including an amino group, carboxylic acid, and protective groups such as benzyloxycarbonyl (Z) and fluorenylmethoxycarbonyl (Fmoc), which are commonly used in peptide synthesis to protect amino functionalities during coupling reactions. The structure suggests potential applications in peptide synthesis and drug development, particularly in the creation of peptide-based therapeutics. Its solubility and stability can vary depending on the pH and solvent conditions, which are critical factors in its handling and application in laboratory settings. Overall, this compound exemplifies the complexity and versatility of synthetic amino acids in medicinal chemistry.
Formula:C27H26N2O6
InChI:InChI=1S/C27H26N2O6/c30-25(31)24(29-27(33)34-16-18-8-2-1-3-9-18)14-15-28-26(32)35-17-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23-24H,14-17H2,(H,28,32)(H,29,33)(H,30,31)/t24-/m0/s1
SMILES:c1ccc(cc1)COC(=N[C@@H](CCN=C(O)OCC1c2ccccc2c2ccccc12)C(=O)O)O
Synonyms:- N-Cbz-N'-Fmoc-L-2,4-Diaminobutyric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
