CAS 15115-52-3
:4-BROMO-1-PHENYL-1H-PYRAZOLE
Description:
4-Bromo-1-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a phenyl group at the 1-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. It may exhibit various properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many pyrazole derivatives. The compound's reactivity can be influenced by the electron-withdrawing nature of the bromine atom and the electron-donating characteristics of the phenyl group, making it a versatile intermediate in organic synthesis. Additionally, 4-bromo-1-phenyl-1H-pyrazole may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in the development of new materials and biologically active compounds.
Formula:C9H7BrN2
InChI:InChI=1/C9H7BrN2/c10-8-6-11-12(7-8)9-4-2-1-3-5-9/h1-7H
SMILES:c1ccc(cc1)n1cc(cn1)Br
Synonyms:- 4-Bromo-1-Phenylpyrazole
- 4-Bromo-1-phenyl-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrazole, 4-bromo-1-phenyl-
CAS:Formula:C9H7BrN2Purity:97%Color and Shape:SolidMolecular weight:223.06934-Bromo-1-phenyl-1H-pyrazole
CAS:4-Bromo-1-phenyl-1H-pyrazoleFormula:C9H7BrN2Purity:97%Color and Shape: brown solidMolecular weight:223.07g/mol4-Bromo-1-phenyl-1H-pyrazole
CAS:Formula:C9H7BrN2Purity:97%Color and Shape:SolidMolecular weight:223.0734-Bromo-1-phenyl-1H-pyrazole
CAS:4-Bromo-1-phenyl-1H-pyrazole is a synthetic chemical that belongs to the group of peroxides. It can be used as a ligand and has been applied in a number of reactions including cross-coupling reactions, ancillary reactions, and bond cleavage. 4-Bromo-1-phenyl-1H-pyrazole is used in organic synthesis as an intermediate for the synthesis of pyrazoles and pyrazole derivatives. The compound is also used as a catalyst for cross coupling reactions with c–h bonds.
Formula:C9H7BrN2Purity:Min. 95%Molecular weight:223.07 g/mol



