CAS 15115-76-1

4-[(4-bromophenyl)sulfanyl]butanoic acid

Description:

4-[(4-Bromophenyl)sulfanyl]butanoic acid, with the CAS number 15115-76-1, is an organic compound characterized by the presence of a butanoic acid moiety linked to a 4-bromophenyl group via a sulfur atom. This compound features a sulfur atom that acts as a bridge between the butanoic acid and the aromatic ring, imparting unique chemical properties. The bromine substituent on the phenyl ring enhances the compound's reactivity and can influence its biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both a carboxylic acid functional group and an aromatic system suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit specific interactions with biological targets due to its structural features, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₁BrO₂S

InChI: InChI=1/C10H11BrO2S/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13)

SMILES: C(CC(=O)O)CSc1ccc(cc1)Br

4-[(4-Bromophenyl)sulfanyl]butanoic acid

CAS: 15115-76-1

Versatile small molecule scaffold

Formula: C₁₀H₁₁BrO₂S

Purity: Min. 95%

Molecular weight: 275.16 g/mol

Ref: 3D-QAA11576