CymitQuimica logo

CAS 151157-45-8

:

Cyclobutanecarboxylic acid, 1-(2-chlorophenyl)-

Description:
Cyclobutanecarboxylic acid, 1-(2-chlorophenyl)-, is an organic compound characterized by its cyclobutane ring structure fused with a carboxylic acid functional group and a 2-chlorophenyl substituent. This compound typically exhibits properties associated with both cyclic and aromatic systems, including potential reactivity due to the presence of the carboxylic acid group, which can participate in acid-base reactions and form esters or amides. The chlorophenyl group introduces additional polarity and can influence the compound's solubility in various solvents, as well as its overall reactivity. The presence of the chlorine atom may also impart unique electronic effects, affecting the compound's stability and interaction with other chemical species. Cyclobutanecarboxylic acid derivatives are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C11H11ClO2
InChI:InChI=1S/C11H11ClO2/c12-9-5-2-1-4-8(9)11(10(13)14)6-3-7-11/h1-2,4-5H,3,6-7H2,(H,13,14)
InChI key:YYPGGXSABCALFA-UHFFFAOYSA-N
SMILES:C1CC(C1)(C2=CC=CC=C2Cl)C(=O)O
Found 4 products.