CAS 15121-94-5
:Primin
Description:
Primin, with the CAS number 15121-94-5, is a chemical compound classified as a phenolic compound, specifically a type of alkaloid. It is primarily derived from the plant species *Primula*, particularly *Primula obconica*. Primin is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. The compound exhibits a characteristic structure that includes a phenolic hydroxyl group, contributing to its reactivity and interaction with biological systems. In terms of physical properties, Primin is typically a solid at room temperature and may have a specific melting point and solubility profile, which can vary depending on the solvent used. Its applications are mainly in the field of natural product chemistry and pharmacology, where it is studied for its therapeutic potential. However, it is important to handle Primin with care, as it may cause skin irritation or allergic reactions in sensitive individuals. Overall, Primin represents an interesting subject of study due to its natural origin and potential health benefits.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-3-4-5-6-9-7-10(13)8-11(15-2)12(9)14/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=WLWIMKWZMGJRBS-UHFFFAOYSA-N
SMILES:C(CCCC)C=1C(=O)C(OC)=CC(=O)C1
Synonyms:- 2-Methoxy-6-pentyl-1,4-benzoquinone
- Primin
- 2,5-Cyclohexadiene-1,4-dione, 2-methoxy-6-pentyl-
- p-Benzoquinone, 2-methoxy-6-pentyl-
- 2-Methoxy-6-pentyl-2,5-cyclohexadiene-1,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Primin
CAS:Primin is a natural product stored in trichomes on leaves and stems of Primula obconica, with antimycobacterial, and strong antineoplastic actions.Formula:C12H16O3Purity:98.47% - 99.91%Color and Shape:SolidMolecular weight:208.25Ref: TM-TN2101
1mg65.00€5mg135.00€1mL*10mM (DMSO)147.00€10mg187.00€25mg319.00€50mg472.00€100mg687.00€Primin
CAS:QuinoneFormula:C12H16O3Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:208.26Primin
CAS:Primin is a naturally occurring compound that is an active chemical constituent primarily derived from the plant *Primula obconica*. It is known for its distinctive biological activity, particularly its anti-inflammatory and allergenic properties. The mode of action of primin involves the inhibition of pro-inflammatory pathways, which helps in reducing inflammation by interfering with specific enzymatic activities and signaling pathways in the cells.Formula:C12H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:208.25 g/mol





