
CAS 151213-16-0
:8-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-3-quinolinecarboxylic acid
Description:
8-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-3-quinolinecarboxylic acid, with CAS number 151213-16-0, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a quinoline core and a pyrrolopyridine moiety. This compound features a chloro and a fluoro substituent, contributing to its unique chemical reactivity and potential biological activity. The presence of the cyclopropyl group may influence its pharmacokinetic properties, such as lipophilicity and metabolic stability. The compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural complexity suggests potential for diverse mechanisms of action, possibly related to its ability to modulate various biological pathways. As with many compounds in this class, understanding its solubility, stability, and reactivity under different conditions is crucial for its application in research and therapeutic contexts.
Formula:C20H21ClFN3O3
InChI:InChI=1S/C20H21ClFN3O3/c21-16-17-12(19(26)13(20(27)28)8-25(17)11-3-4-11)6-14(22)18(16)24-7-10-2-1-5-23-15(10)9-24/h6,8,10-11,15,23H,1-5,7,9H2,(H,27,28)/t10-,15+/m0/s1
InChI key:InChIKey=VRXORHRXNRJZCQ-ZUZCIYMTSA-N
SMILES:ClC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N3C[C@]4([C@@](C3)(NCCC4)[H])[H])C5CC5
Synonyms:- 6H-Pyrrolo[3,4-b]pyridine, 3-quinolinecarboxylic acid deriv.
- 3-Quinolinecarboxylic acid, 8-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-7-(octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl)-4-oxo-, (4aS-cis)-
- 8-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-3-quinolinecarboxylic acid
- 3-Quinolinecarboxylic acid, 8-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
BAY-Y 3118
CAS:<p>BAY-Y 3118 is a synthetic compound specifically designed as a radiolabeled dopamine D4 receptor antagonist. It is sourced from chemical synthesis processes that enable modification of molecular structures to target specific biological receptors. The mode of action of BAY-Y 3118 involves binding to the D4 subtype of dopamine receptors, which are G protein-coupled receptors located in the central nervous system. This binding is typically labeled with a radiolabel to facilitate tracking and visualization in biological assays.</p>Formula:C20H21ClFN3O3Purity:Min. 95%Molecular weight:405.8 g/molBAY-Y 3118
CAS:<p>BAY-Y 3118, a new chlorofluoroquinolone, has antimicrobial activity.</p>Formula:C20H21ClFN3O3Color and Shape:SolidMolecular weight:405.85

