CAS 151250-94-1

4-(1-adamantyl)-6-amino-1,3,5-trazin-2-ol

Description:

4-(1-Adamantyl)-6-amino-1,3,5-trazin-2-ol, with the CAS number 151250-94-1, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This particular compound features an adamantyl group, which is a bicyclic structure known for its stability and hydrophobic properties, contributing to the compound's overall lipophilicity. The presence of an amino group and a hydroxyl group in its structure suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structural features could also impart specific properties such as selective binding to biological targets or modulation of biological pathways. Overall, 4-(1-adamantyl)-6-amino-1,3,5-trazin-2-ol represents a compound with potential applications in medicinal chemistry, though further studies would be necessary to fully elucidate its characteristics and functionalities.

Formula: C₁₃H₁₈N₄O

InChI: InChI=1/C13H18N4O/c14-11-15-10(16-12(18)17-11)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2,(H3,14,15,16,17,18)

SMILES: C1C2CC3CC1CC(C2)(C3)c1nc(=N)[nH]c(n1)O

Synonyms:

• 4-amino-6-(tricyclo[3.3.1.1~3,7~]dec-1-yl)-1,3,5-triazin-2(5H)-one

2-(Adamant-1-yl)-4-amino-6-hydroxy-1,3,5-triazine

CAS: 151250-94-1

2-(Adamant-1-yl)-4-amino-6-hydroxy-1,3,5-triazine

Purity: ≥95%

Molecular weight: 246.31g/mol

Ref: 54-OR27324