CAS 151271-53-3
:UK 1
Description:
UK 1, with the CAS number 151271-53-3, is a chemical compound that has been studied primarily for its potential applications in pharmacology and biochemistry. It is characterized by its specific molecular structure, which influences its biological activity and interaction with various biological targets. UK 1 is often associated with research in the field of medicinal chemistry, particularly in the development of therapeutic agents. Its properties may include solubility in organic solvents, stability under certain conditions, and specific reactivity with other chemical entities. The compound's efficacy and safety profile would typically be evaluated through various in vitro and in vivo studies, contributing to its potential use in drug development. As with any chemical substance, handling and usage guidelines are essential to ensure safety and compliance with regulatory standards. Further research may continue to elucidate its mechanisms of action and potential therapeutic applications.
Formula:C22H14N2O5
InChI:InChI=1/C22H14N2O5/c1-27-22(26)14-8-5-11-17-19(14)24-21(29-17)13-7-4-10-16-18(13)23-20(28-16)12-6-2-3-9-15(12)25/h2-11,23H,1H3/b20-12+
Synonyms:- Methyl 2'-(2-hydroxyphenyl)-(2,4'-bibenzoxazole)-4-carboxylate
- (2,4'-Bibenzoxazole)-4-carboxylic acid, 2'-(2-hydroxyphenyl)-, methyl ester
- methyl (2'E)-2'-(6-oxocyclohexa-2,4-dien-1-ylidene)-2',3'-dihydro-2,4'-bi-1,3-benzoxazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
[2,4'-Bibenzoxazole]-4-carboxylic acid, 2'-(2-hydroxyphenyl)-, methyl ester
CAS:Formula:C22H14N2O5Color and Shape:SolidMolecular weight:386.357


