CAS 151290-84-5

Ethyl 5-amino-1-methyl-3-(methylthio)-1H-pyrazole-4-carboxylate

Description:

Ethyl 5-amino-1-methyl-3-(methylthio)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group and a methylthio group enhances its potential for biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its properties, such as melting point, boiling point, and solubility, are influenced by the functional groups present, which can affect its interactions with other molecules. Ethyl 5-amino-1-methyl-3-(methylthio)-1H-pyrazole-4-carboxylate may also exhibit specific pharmacological activities, making it a candidate for further investigation in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₁₃N₃O₂S

InChI: InChI=1S/C8H13N3O2S/c1-4-13-8(12)5-6(9)11(2)10-7(5)14-3/h4,9H2,1-3H3

InChI key: InChIKey=SYOQMLHHWLPSBZ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(SC)=NN(C)C1N

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 5-amino-1-methyl-3-(methylthio)-, ethyl ester
• Ethyl 5-amino-1-methyl-3-(methylthio)-1H-pyrazole-4-carboxylate