CAS 1513-66-2
:2,3-Difluoropyridine
Description:
2,3-Difluoropyridine is a heterocyclic aromatic compound characterized by a pyridine ring with two fluorine substituents at the 2 and 3 positions. Its molecular formula is C5H4F2N, and it has a molecular weight that reflects the presence of these elements. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is polar due to the electronegative fluorine atoms, which can influence its solubility in various solvents. 2,3-Difluoropyridine is used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is enhanced by the presence of the fluorine atoms, which can participate in nucleophilic substitution reactions. Additionally, the compound exhibits properties typical of pyridine derivatives, such as basicity and the ability to form coordination complexes with metals. Safety precautions should be taken when handling this substance, as it may be harmful if inhaled or ingested, and it can cause skin and eye irritation.
Formula:C5H3F2N
InChI:InChI=1S/C5H3F2N/c6-4-2-1-3-8-5(4)7/h1-3H
InChI key:InChIKey=OGVLEPMNNPZAPS-UHFFFAOYSA-N
SMILES:FC1=C(F)N=CC=C1
Synonyms:- 2,3-Difluorpyridin
- Pyridine, 2,3-difluoro-
- 2,3-Difluoropyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,3-Difluoropyridine
CAS:Formula:C5H3F2NPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:115.08Pyridine, 2,3-difluoro-
CAS:Formula:C5H3F2NPurity:95%Color and Shape:LiquidMolecular weight:115.08082,3-Difluoropyridine
CAS:2,3-DifluoropyridineFormula:C5H3F2NPurity:97%Color and Shape: clear. colourless liquidMolecular weight:115.08g/mol2,3-Difluoropyridine
CAS:Formula:C5H3F2NPurity:95%Color and Shape:Liquid, Clear colourless liquidMolecular weight:115.0832,3-Difluoropyridine
CAS:Controlled ProductFormula:C5H3F2NColor and Shape:NeatMolecular weight:115.082,3-Difluoro pyridine
CAS:<p>2,3-Difluoro pyridine is an organic compound with the chemical formula C6H3F2N. It is a colorless liquid that has a strong odor and a boiling point of 147°C. 2,3-Difluoro pyridine has antibacterial properties and can be used to treat bacterial infections by inhibiting the synthesis of proteins in bacterial cells. This inhibition prevents the formation of new cell walls, which leads to cell death. 2,3-Difluoro pyridine is also used as an intermediate in organic chemistry reactions involving hydrogen fluoride. The transport properties of this compound are low due to its high melting point and low solubility in water. There are three different polymorphs for 2,3-difluoropyridine: form II, form III and form IV, with form II being the most common. Form II has a trigonal planar molecular geometry, whereas forms III and IV have tetragonal</p>Formula:C5H3F2NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:115.08 g/mol






