CAS 15131-80-3
:2,2'-DIHYDROXYCHALCONE
Description:
2,2'-Dihydroxychalcone is an organic compound belonging to the chalcone family, characterized by its structure that includes two hydroxyl (-OH) groups attached to the chalcone backbone. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. It has a molecular formula that reflects its dihydroxy substitution, contributing to its reactivity and interaction with various biological systems. 2,2'-Dihydroxychalcone is often studied in the context of medicinal chemistry and natural product research, as it may serve as a lead compound for the development of new therapeutic agents. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various applications in research and industry. Additionally, its ability to modulate certain biochemical pathways highlights its significance in pharmacological studies. Overall, 2,2'-dihydroxychalcone is a compound of interest due to its diverse potential applications in health and disease management.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-13-7-3-1-5-11(13)9-10-15(18)12-6-2-4-8-14(12)17/h1-10,16-17H/b10-9+
InChI key:InChIKey=KSHCTKZLHCSARH-UHFFFAOYSA-N
SMILES:C(C=CC1=C(O)C=CC=C1)(=O)C2=C(O)C=CC=C2
Synonyms:- (2E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one
- 1,3-Bis(2-Hydroxyphenyl)-2-Propen-1-On
- 1,3-Bis(2-Hydroxyphenyl)-2-Propen-1-One
- 1,3-Di(2-Hydroxyphenyl)Prop-2-En-1-One
- 2,2'-Dihydroxychalchone
- 2-Propen-1-one, 1,3-bis(2-hydroxyphenyl)-
- 2’-Hydroxy-3-(O-Hydroxyphenyl)-Acrylophenon
- Chalcone, 2,2′-dihydroxy-
- NSC 636811
- NSC 73256
- 2,2′-Dihydroxychalcone
- Acrylophenone, 2'-hydroxy-3-(o-hydroxyphenyl)-
- trans-2,2'-dihydroxychalcone
- (E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one
- 1,3-Bis-(2-hydroxyphenyl)prop-2-en-1-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2'-Dihydroxy chalcone
CAS:<p>2,2'-Dihydroxy chalcone inhibits β-glucuronidase (IC50=1.6 μM) and lysozyme (IC50=1.4 μM), and fights E. coli, S. fowleri, S. albicans, S. aureus.</p>Formula:C15H12O3Purity:99.7%Color and Shape:SolidMolecular weight:240.252,2'-Dihydroxychalcone
CAS:<p>2,2'-Dihydroxychalcone is a naturally-derived phenolic compound, which is primarily sourced from various plant species, including those within the genus Glycyrrhiza. This compound functions through its antioxidative mode of action, where it effectively scavenges free radicals and mitigates oxidative stress. Its molecular structure allows it to donate hydrogen atoms, thereby stabilizing reactive oxygen species and preventing cellular damage.</p>Formula:C15H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:240.25 g/mol



