
CAS 151391-69-4
:(2E,4E,12Z)-N-(2-Methylpropyl)-2,4,12-octadecatrienamide
Description:
(2E,4E,12Z)-N-(2-Methylpropyl)-2,4,12-octadecatrienamide is a chemical compound characterized by its long carbon chain and multiple double bonds, specifically three conjugated double bonds located at the 2, 4, and 12 positions of the octadecatriene backbone. The presence of the N-(2-Methylpropyl) substituent indicates that it has an amide functional group, which contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of unsaturated fatty acids and amides, such as being lipophilic and having potential applications in fields like biochemistry and pharmacology. Its structural configuration, denoted by the E and Z notation, suggests specific geometric isomerism, which can influence its interactions with biological systems. The compound may also possess unique physical properties, such as melting and boiling points, which are influenced by its molecular structure and the presence of double bonds. Overall, this compound's characteristics make it of interest for various scientific studies, particularly in the context of lipid chemistry and potential therapeutic applications.
Formula:C22H39NO
InChI:InChI=1S/C22H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)23-20-21(2)3/h8-9,16-19,21H,4-7,10-15,20H2,1-3H3,(H,23,24)/b9-8-,17-16+,19-18+
InChI key:InChIKey=PCWWIOUZYOPZHT-VBUSEHTESA-N
SMILES:C(=C/C(NCC(C)C)=O)\C=C\CCCCCC/C=C\CCCCC
Synonyms:- (2E,4E,12Z)-N-(2-Methylpropyl)-2,4,12-octadecatrienamide
- 2,4,12-Octadecatrienamide, N-(2-methylpropyl)-, (2E,4E,12Z)-
- 2,4,12-Octadecatrienamide, N-(2-methylpropyl)-, (E,E,Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Isobutyl-2,4,12-octadecatrienamide
CAS:<p>N-Isobutyl-2,4,12-octadecatrienamide is a useful organic compound for research related to life sciences.</p>Formula:C22H39NOColor and Shape:SolidMolecular weight:333.56
