CAS 151411-98-2

2,4,6-Trifluorobenzyl bromide

Description:

2,4,6-Trifluorobenzyl bromide is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms at the 2, 4, and 6 positions, and a bromomethyl group at the 1-position. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the preparation of various fluorinated compounds. The trifluoromethyl groups contribute to the compound's unique electronic properties, enhancing its lipophilicity and stability. Additionally, the presence of fluorine atoms can influence the compound's boiling point and solubility in organic solvents. As with many halogenated compounds, 2,4,6-Trifluorobenzyl bromide should be handled with care due to potential toxicity and environmental concerns associated with halogenated organic substances. Proper safety measures and disposal protocols are essential when working with this compound.

Formula: C₇H₄BrF₃

InChI: InChI=1/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2

SMILES: c1c(cc(c(CBr)c1F)F)F

Synonyms:

• alpha-Bromo-2,4,6-trifluorotoluene
• 2-(Bromomethyl)-1,3,5-Trifluorobenzene

Benzene, 2-(bromomethyl)-1,3,5-trifluoro-

CAS: 151411-98-2

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 225.0059

Ref: IN-DA001NB9

2,4,6-Trifluorobenzyl bromide

CAS: 151411-98-2

2,4,6-Trifluorobenzyl bromide

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: pale yellow liquid

Molecular weight: 225.01g/mol

Ref: 54-PC7285T

2,4,6-Trifluorobenzyl bromide

CAS: 151411-98-2

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 225.008

Ref: 10-F007506