CAS 151464-91-4
:3-tert-Butyl-2,4-dimethylpyrrole
Description:
3-tert-Butyl-2,4-dimethylpyrrole is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a tert-butyl group at the 3-position and two methyl groups at the 2 and 4 positions of the pyrrole ring, contributing to its unique steric and electronic properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bulky tert-butyl group influences its solubility and reactivity, making it less polar compared to other pyrrole derivatives. This compound may exhibit interesting chemical behavior, including potential applications in organic synthesis and materials science, particularly in the development of ligands or catalysts. Its stability and reactivity can be affected by the substituents on the pyrrole ring, which can also influence its interactions with other chemical species. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C10H17N
InChI:InChI=1/C10H17N/c1-7-6-11-8(2)9(7)10(3,4)5/h6,11H,1-5H3
SMILES:Cc1c[nH]c(C)c1C(C)(C)C
Synonyms:- 2,4-Dimethyl-3-butylpyrrole
- 3-tert-butyl-2,4-dimethyl-1H-pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.