CAS 151466-23-8

(2Z)-2-isoxazol-3(2H)-ylidene-2,6,7,9-tetrahydroimidazo[4,5-d]pyrano[4,3-b]pyridine phosphate

Description:

(2Z)-2-isoxazol-3(2H)-ylidene-2,6,7,9-tetrahydroimidazo[4,5-d]pyrano[4,3-b]pyridine phosphate is a complex organic compound characterized by its unique structural features, including an isoxazole ring and a tetrahydroimidazo-pyrano-pyridine framework. This compound exhibits a range of chemical properties due to the presence of multiple functional groups, which can influence its reactivity and interactions with biological systems. The phosphate group suggests potential applications in biochemistry, particularly in relation to enzyme activity or as a signaling molecule. The stereochemistry indicated by the (2Z) configuration implies specific spatial arrangements that can affect the compound's biological activity and binding affinity. Additionally, the presence of nitrogen-containing heterocycles may contribute to its pharmacological properties, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's intricate structure and functional diversity position it as a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₃N₄O₆P

InChI: InChI=1/C12H10N4O2.H3O4P/c1-3-17-6-7-8(1)13-5-10-11(7)15-12(14-10)9-2-4-18-16-9;1-5(2,3)4/h2,4-5,16H,1,3,6H2;(H3,1,2,3,4)/b12-9+;

S-8510 phosphate

CAS: 151466-23-8

S-8510 phosphate is an agonist of inverse Benzodiazepine (BDZ) receptor(Kis of 34.6 nM, 36.2 nM for –GABA and +GABA respectively).

Formula: C₁₂H₁₃N₄O₆P

Purity: 98%

Color and Shape: Solid

Molecular weight: 340.23

Ref: TM-T12792