CAS 1515-14-6: Hexafluoro-2-methylisopropanol
Description:Hexafluoro-2-methylisopropanol, with the CAS number 1515-14-6, is a fluorinated alcohol characterized by the presence of six fluorine atoms attached to a carbon backbone that includes a methyl group and an isopropanol structure. This compound is typically a colorless liquid at room temperature and is known for its high polarity and low volatility, which can enhance its solubility in various solvents. The presence of fluorine atoms imparts unique properties, such as increased chemical stability and resistance to oxidation. Hexafluoro-2-methylisopropanol is often utilized in specialized applications, including as a solvent in chemical reactions and as a reagent in organic synthesis. Its unique characteristics make it valuable in the development of fluorinated compounds and materials. Additionally, due to its fluorinated nature, it may exhibit low surface tension and high thermal stability, making it suitable for use in various industrial processes. However, handling precautions are necessary due to potential environmental and health impacts associated with fluorinated compounds.
Formula:C4H4F6O
InChI:InChI=1S/C4H4F6O/c1-2(11,3(5,6)7)4(8,9)10/h11H,1H3
InChI key:InChIKey=FQDXJYBXPOMIBX-UHFFFAOYSA-N
SMILES:FC(F)(F)C(O)(C)C(F)(F)F
- Synonyms:
- 1,1,1,3,3,3-Hexafluoro-2-Methylpropan-2-Ol
- 1,1,1,3,3,3-Hexafluoro-2-hydroxy-2-methylpropane
- 1,1,1,3,3,3-Hexafluoro-2-methyl-2-propanol
- 1,1,1-Trifluoro-2-trifluoromethyl-2-propanol
- 1,1-Bis(trifluoromethyl)ethanol
- 2-Methyl-1,1,1,3,3,3-Hexafluoro-2-Propanol
- 2-Methylhexafluoro-2-propanol
- 2-Propanol, 1,1,1,3,3,3-hexafluoro-2-methyl-
- Hexafluoro-tert-butanol
- Hexafluoro-tert-butyl alcohol
- See more synonyms
- Methyl bis(trifluoromethyl) carbinol

Hexafluoro-2-methylisopropanol, min. 97%
Ref: 08-09-4765
5g | 164.00 € | ||
25g | 603.00 € |

2-Propanol, 1,1,1,3,3,3-hexafluoro-2-methyl-
Ref: IN-DA001NDV
1g | 48.00 € | ||
5g | 99.00 € | ||
25g | 268.00 € | ||
100g | To inquire |

1,1,1,3,3,3-Hexafluoro-2-methyl-2-propanol [for HPLC]
Ref: 3B-H1861
5g | 134.00 € |

Ref: 04-A50000413WA
1ml | To inquire |

1,1,1,3,3,3-Hexafluoro-2-methyl-2-propanol
Ref: 3B-H1349
5g | 95.00 € | ||
25g | 356.00 € |

Hexafluoro-2-methylpropan-2-ol
Ref: 54-PC4765
5g | 131.00 € | ||
25g | 383.00 € |

Hexafluoro-2-methylisopropanol
Ref: 10-F001512
1g | 32.00 € | ||
5g | 98.00 € | ||
25g | To inquire | ||
100g | To inquire |

1,1,1,3,3,3-Hexafluoro-2-methyl-2-propanol
Ref: TR-H294400
1g | 108.00 € |

1,1,1,3,3,3-Hexafluoro-2-methylisopropanol
Ref: 3D-FH101141
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |