CymitQuimica logo

CAS 15150-84-2

:

3-PHENYL-PYRIDAZINE

Description:
3-Phenyl-pyridazine is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 2. The presence of a phenyl group at the 3-position of the pyridazine ring contributes to its aromatic properties and influences its reactivity and interactions. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The molecular structure of 3-phenyl-pyridazine allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its unique electronic properties, stemming from the conjugation between the phenyl and pyridazine moieties, can lead to interesting photophysical behaviors. As with many nitrogen-containing heterocycles, it may also exhibit biological activity, warranting further investigation into its pharmacological potential.
Formula:C10H8N2
InChI:InChI=1/C10H8N2/c1-2-5-9(6-3-1)10-7-4-8-11-12-10/h1-8H
SMILES:c1ccc(cc1)c1cccnn1
Synonyms:
  • Aurora Ka-559
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.