CAS 15151-14-1

2-methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one

Description:

2-Methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one, with the CAS number 15151-14-1, is a synthetic organic compound belonging to the class of flavonoids. This compound features a complex structure that includes a pyran ring fused to a chromenone moiety, which contributes to its potential biological activities. It is characterized by its aromatic phenyl group and a methyl substituent, which can influence its solubility and reactivity. The presence of the chromenone structure suggests that it may exhibit various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities, making it of interest in medicinal chemistry. Additionally, its unique structural features may allow for interactions with biological targets, potentially leading to therapeutic applications. The compound is typically studied in the context of its synthesis, characterization, and biological evaluation, contributing to the broader understanding of flavonoid derivatives in drug development and natural product chemistry.

Formula: C₁₉H₁₄O₃

InChI: InChI=1/C19H14O3/c1-12-11-15(13-7-3-2-4-8-13)17-18(21-12)14-9-5-6-10-16(14)22-19(17)20/h2-11,15H,1H3

SMILES: CC1=CC(c2ccccc2)c2c(c3ccccc3oc2=O)O1

rac-2-Methyl-4-phenyl-4H-pyrano[3,2-c]benzopyran-5-one

Controlled Product

CAS: 15151-14-1

Applications Intermediate in the preparation of Warfarin metabolites
References Chan, K., et al.: J. Med. Chem., 15, 1265 (1972),

Formula: C₁₉H₁₄O₃

Color and Shape: Neat

Molecular weight: 290.31

Ref: TR-M320630