CAS 15151-14-1
:2-methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one
Description:
2-Methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one, with the CAS number 15151-14-1, is a synthetic organic compound belonging to the class of flavonoids. This compound features a complex structure that includes a pyran ring fused to a chromenone moiety, which contributes to its potential biological activities. It is characterized by its aromatic phenyl group and a methyl substituent, which can influence its solubility and reactivity. The presence of the chromenone structure suggests that it may exhibit various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities, making it of interest in medicinal chemistry. Additionally, its unique structural features may allow for interactions with biological targets, potentially leading to therapeutic applications. The compound is typically studied in the context of its synthesis, characterization, and biological evaluation, contributing to the broader understanding of flavonoid derivatives in drug development and natural product chemistry.
Formula:C19H14O3
InChI:InChI=1/C19H14O3/c1-12-11-15(13-7-3-2-4-8-13)17-18(21-12)14-9-5-6-10-16(14)22-19(17)20/h2-11,15H,1H3
SMILES:CC1=CC(c2ccccc2)c2c(c3ccccc3oc2=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rac-2-Methyl-4-phenyl-4H-pyrano[3,2-c]benzopyran-5-one
CAS:Controlled Product<p>Applications Intermediate in the preparation of Warfarin metabolites<br>References Chan, K., et al.: J. Med. Chem., 15, 1265 (1972),<br></p>Formula:C19H14O3Color and Shape:NeatMolecular weight:290.31
