CAS 151519-02-7
:PIRONETIN
Description:
Pironetin, identified by its CAS number 151519-02-7, is a chemical compound that belongs to the class of substances known as natural products, specifically derived from plant sources. It is characterized by its unique molecular structure, which contributes to its biological activity. Pironetin has been studied for its potential pharmacological properties, including its role as an anti-cancer agent, as it has shown the ability to inhibit cell proliferation in certain cancer cell lines. The compound operates through mechanisms that may involve the disruption of microtubule dynamics, which is crucial for cell division. Additionally, Pironetin exhibits selectivity towards specific types of cancer cells, making it a subject of interest in medicinal chemistry and drug development. Its solubility and stability in various solvents can influence its bioavailability and efficacy. As with many chemical substances, further research is necessary to fully elucidate its mechanisms of action, therapeutic potential, and safety profile in clinical applications.
Formula:C19H32O4
InChI:InChI=1/C19H32O4/c1-6-8-9-13(3)19(22-5)14(4)16(20)12-17-15(7-2)10-11-18(21)23-17/h6,8,10-11,13-17,19-20H,7,9,12H2,1-5H3/b8-6+/t13-,14-,15+,16+,17+,19+/m0/s1
Synonyms:- 5-Ethyl-5,6-dihydro-6-(2-hydroxy-4-methoxy-3,5-dimethyl-7-nonenyl)-2H-pyran-2-one
- Pa 48153C
- 2H-Pyran-2-one, 5-ethyl-5,6-dihydro-6-(2-hydroxy-4-methoxy-3,5-dimethyl-7-nonenyl)-, (5R-(5alpha,6alpha(2R*,3S*,4R*,5S*,7E)))-
- (5R,6R)-5-ethyl-6-[(2R,3S,4R,5S,7E)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-en-1-yl]-5,6-dihydro-2H-pyran-2-one
- Pironetin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pironetin
CAS:Pironetin, from Streptomyces, inhibits microtubule polymerization and tumor growth, and causes cell cycle arrest.Formula:C19H32O4Purity:98%Color and Shape:SolidMolecular weight:324.45Pironetin
CAS:<p>Pironetin</p>Purity:By hplc: 100% (Typical Value in Batch COA)Color and Shape: whitish amorphous solidMolecular weight:324.45g/molPironetin
CAS:Pironetin is a benzyl-containing natural product that inhibits the growth of leukemia cells in culture. It has a carbonic anhydrase inhibitory activity, which may be responsible for its antitumour activity. Pironetin is also shown to have anti-inflammatory properties by inhibiting the production of reactive oxygen species and tumor necrosis factor-α. The mechanism of this inhibition is not yet known. Pironetin also has carnitinease inhibitory activity and reacts with disulfides in proteins, resulting in protein degradation.Formula:C19H32O4Purity:Min. 95%Molecular weight:324.5 g/mol


