CAS 151533-22-1: L-5-Methyltetrahydrofolate calcium
Description:L-5-Methyltetrahydrofolate calcium, with the CAS number 151533-22-1, is a biologically active form of folate, which is a B-vitamin essential for various metabolic processes in the body. This compound serves as a coenzyme in the synthesis of amino acids and nucleic acids, playing a crucial role in DNA synthesis and repair, as well as in the metabolism of homocysteine. It is particularly important for cellular division and growth, making it vital during pregnancy and for overall health. L-5-Methyltetrahydrofolate is water-soluble and typically exists as a calcium salt to enhance stability and solubility. Its bioavailability is higher than that of folic acid, making it a preferred choice in dietary supplements, especially for individuals with certain genetic polymorphisms that affect folate metabolism. Additionally, it is often used in clinical settings to address folate deficiency and related health issues. The compound is generally regarded as safe when used appropriately, but it is essential to consult healthcare professionals for personalized advice regarding supplementation.
Formula:C20H23CaN7O6
InChI:InChI=1/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12-,13-;/m0./s1
- Synonyms:
- L-Methylfolate, calcium
- CALCIUML-5-METHYLTETRAHYDROFOLATE
- Calcium L-5-Methyltetrahydrofolate
- (6S)-N-[4-(2-Amino-1,4,5,6,7,8,-hexahydro-5-methyl-4-oxo-6-pteridinylmethylamino)benzoyl]-L-glutaminsure, Calciumsalz (1:1)
- L-5-MTHF-Ca
- L-Methyltetrahydrofolate, calcium salt
- L-5-Methyltetrahydrofolic acid, calcium salt
- Calcium levomefolate