CAS 15155-41-6
:4,7-DIBROMO-2,1,3-BENZOTHIADIAZOLE
Description:
4,7-Dibromo-2,1,3-benzothiadiazole is a heterocyclic compound characterized by its fused benzene and thiadiazole rings, which contribute to its unique chemical properties. This compound features two bromine substituents at the 4 and 7 positions of the benzothiadiazole ring, enhancing its reactivity and potential applications in various fields. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of bromine atoms increases its electron-withdrawing characteristics, making it useful in electronic materials and as a building block in organic synthesis. Additionally, its structure allows for potential applications in dye chemistry and as a precursor in the development of agrochemicals. The compound is also of interest in the field of materials science, particularly in the development of semiconductors and photovoltaic devices. Safety precautions should be taken when handling this substance, as it may pose health risks due to its brominated nature.
Formula:C6H2Br2N2S
InChI:InChI=1/C6H2Br2N2S/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H
SMILES:c1cc(c2c(c1Br)nsn2)Br
Synonyms:- 4,7-Dibromo-2,1,3-Benzothidiazole
- 4,7-Dibromobenzo[c][1,2,5]thiadiazole
- K0092
- BTD
- 4,7-DibroMo-1,2,3-benzothiadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,7-Dibromo-2,1,3-benzothiadiazole, 97%
CAS:4,7-Dibromo-2,1,3-benzothiadiazole is the building block or monomer for the synthesis of light-emitting diodes and conducting polymers for organic electronics. It is used as an intermediate for the synthesis of poly[N-9'-heptadecanyl-2,7-carbazole-alt-5,5-(4',7'-di-2-thienyl-2',1',3'-benzothiadiazFormula:C6H2Br2N2SPurity:97%Color and Shape:White to yellow to brown, Powder or crystalline powder or crystals or chunksMolecular weight:293.962,1,3-Benzothiadiazole, 4,7-dibromo-
CAS:Formula:C6H2Br2N2SPurity:97%Color and Shape:SolidMolecular weight:293.96654,7-Dibromo-2,1,3-benzothiadiazole
CAS:Formula:C6H2Br2N2SPurity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:293.964,7-Dibromo-2,1,3-benzothiadiazole
CAS:4,7-Dibromo-2,1,3-benzothiadiazoleFormula:C6H2Br2N2SPurity:≥95%Color and Shape: light yellow to brown solidMolecular weight:293.97g/mol4,7-Dibromo-2,1,3-benzothiadiazole
CAS:Formula:C6H2Br2N2SPurity:95%Color and Shape:Solid, Yellow powderMolecular weight:293.96




