CAS 1516-60-5
:4-Nitrophenyl azide
Description:
4-Nitrophenyl azide is an organic compound characterized by the presence of an azide functional group (-N3) attached to a 4-nitrophenyl moiety. It is typically a yellow crystalline solid, known for its sensitivity to heat and shock, which makes it a potential explosive material. The compound has a molecular formula of C7H6N4O2 and features a nitro group (-NO2) that contributes to its reactivity and stability under certain conditions. 4-Nitrophenyl azide is often used in organic synthesis, particularly in the field of click chemistry, where it can participate in various reactions, including the formation of triazoles through cycloaddition with alkynes. Its azide group can also serve as a versatile functional handle for further chemical modifications. Due to its hazardous nature, proper safety precautions are essential when handling this compound, including the use of appropriate personal protective equipment and adherence to safety protocols in a controlled laboratory environment.
Formula:C6H4N4O2
InChI:InChI=1S/C6H4N4O2/c7-9-8-5-1-3-6(4-2-5)10(11)12/h1-4H
InChI key:InChIKey=CZZVSJPFJBUBDK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N=[N+]=[N-])C=C1
Synonyms:- Benzene, 1-azido-4-nitro-
- 1-Azido-4-nitrobenzene
- p-Nitrophenyl azide
- 4-Nitrophenyl azide
- p-Azidonitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Azido-4-nitrobenzene 0.1M in MeTHF 100mg = 6.25mL solution
CAS:Formula:C6H4N4O2Purity:97.0%Molecular weight:164.1241-Azido-4-nitrobenzene
CAS:1-Azido-4-nitrobenzene is a chemical compound with the molecular formula C6H5N3O2, which is derived from nitrobenzene. It has the ability to react with primary amines to form diarylamines and aziridination. 1-Azido-4-nitrobenzene has antiviral properties and can be used in the synthesis of a number of pharmaceuticals, such as chloramphenicol and zanamivir. The compound may also be used in the synthesis of dyes, explosives, and other products. 1-Azido-4-nitrobenzene reacts with chloride to produce carbon tetrachloride and nitrogen gas. This reaction can be used to make transfer reactions with other compounds, such as alkenes or ketones.
Formula:C6H4N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:164.12 g/molRef: 3D-BAA51660
Discontinued product

