CAS 1516-64-9
:(2E)-1,1,1,2,3,4,4,4-Octafluoro-2-butene
Description:
(2E)-1,1,1,2,3,4,4,4-Octafluoro-2-butene, with the CAS number 1516-64-9, is a fluorinated organic compound characterized by its unique structure and properties. It is a colorless gas at room temperature and exhibits a low boiling point, making it volatile. The presence of multiple fluorine atoms contributes to its high stability and low reactivity, which are typical of perfluorinated compounds. This substance is non-flammable and has a low toxicity profile, although it can be harmful to the environment due to its potential to contribute to greenhouse gas effects. Its molecular structure includes a double bond, which imparts specific geometric isomerism, with the (2E) designation indicating the configuration around the double bond. Octafluoro-2-butene is primarily used in specialized applications, including as a refrigerant and in the production of fluorinated polymers. Its unique properties make it valuable in various industrial processes, although environmental considerations regarding its persistence and potential effects are important in its usage and regulation.
Formula:C4F8
InChI:InChI=1S/C4F8/c5-1(3(7,8)9)2(6)4(10,11)12/b2-1+
InChI key:InChIKey=WSJULBMCKQTTIG-OWOJBTEDSA-N
SMILES:C(=C(/C(F)(F)F)\F)(\C(F)(F)F)/F
Synonyms:- (2E)-1,1,1,2,3,4,4,4-Octafluoro-2-butene
- (2E)-1,1,1,2,3,4,4,4-octafluorobut-2-ene
- (2Z)-1,1,1,2,3,4,4,4-octafluorobut-2-ene
- (E)-Perfluoro-2-butene
- 2-Butene, 1,1,1,2,3,4,4,4-octafluoro-, (2E)-
- 2-Butene, 1,1,1,2,3,4,4,4-octafluoro-, (E)-
- E-PFC 1318my
- trans-Octafluoro-2-butene
- trans-Perfluoro-2-butene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-F-204011
Discontinued product

