CAS 151606-29-0
:Zinquin Ethyl Ester
Description:
Zinquin Ethyl Ester, with the CAS number 151606-29-0, is a chemical compound primarily used as a fluorescent probe for detecting zinc ions in biological systems. It is characterized by its ability to selectively bind zinc, resulting in a significant increase in fluorescence, which allows for sensitive imaging and quantification of zinc levels in cells and tissues. The compound typically exhibits a high affinity for zinc ions, making it an effective tool in biochemical research, particularly in studies related to zinc's role in cellular processes and signaling pathways. Zinquin Ethyl Ester is often utilized in live-cell imaging due to its cell-permeable nature, enabling researchers to monitor zinc dynamics in real-time. Additionally, its fluorescence properties can be influenced by environmental factors such as pH and the presence of other metal ions, which is crucial for interpreting experimental results accurately. Overall, Zinquin Ethyl Ester serves as a valuable reagent in the field of biochemistry and molecular biology for studying zinc-related functions in various biological contexts.
Formula:C19H18N2O5S
InChI:InChI=1/C19H18N2O5S/c1-12-3-7-16(8-4-12)27(24,25)21-17-10-15(26-11-18(22)23)9-14-6-5-13(2)20-19(14)17/h3-10,21H,11H2,1-2H3,(H,22,23)
SMILES:Cc1ccc(cc1)S(=O)(=O)Nc1cc(cc2ccc(C)nc12)OCC(=O)O
Synonyms:- Zinquin
- (2-Methyl-8-p-toluenesulfonamido-6-quinolyloxy)acetic acid
- Ethyl (2-methyl-8-p-toluenesulfonamido-6-quinolyloxy)acetate
- Acetic acid, ((2-methyl-8-(((4-methylphenyl)sulfonyl)amino)-6-quinolinyl)oxy)-
- [(2-Methyl-8-{[(4-Methylphenyl)Sulfonyl]Amino}Quinolin-6-Yl)Oxy]Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-[[2-methyl-8-[[(4-methylphenyl)sulfonyl]amino]-6-quinolinyl]oxy]-
CAS:Formula:C19H18N2O5SPurity:98%Color and Shape:SolidMolecular weight:386.4216Zinquin
CAS:Formula:C19H18N2O5SPurity:≥ 95.0%Color and Shape:White to off-white solidMolecular weight:386.42Zinquin
CAS:<p>Zinquin is a fluorescent sensor used in the observation of reactive Zn2+ (λex: 364 nm, em: 385 nm).</p>Formula:C19H18N2O5SPurity:98%Color and Shape:SolidMolecular weight:386.42




