CymitQuimica logo

CAS 15163-36-7

:

3-(decyldimethylammonio)propanesulfonate

Description:
3-(Decyldimethylammonio)propanesulfonate, with the CAS number 15163-36-7, is a quaternary ammonium compound characterized by its surfactant properties. It features a long hydrophobic decyl chain, which contributes to its ability to interact with lipid membranes and enhance solubility in non-polar environments. The presence of a sulfonate group imparts water solubility, making it an effective amphiphilic molecule. This compound is often used in various applications, including as a surfactant in detergents, emulsifiers, and in biological research for cell membrane studies. Its cationic nature allows it to interact with negatively charged surfaces, which can be beneficial in formulations aimed at microbial control or in the stabilization of emulsions. Additionally, it may exhibit antimicrobial properties, making it useful in personal care products and industrial applications. Overall, 3-(decyldimethylammonio)propanesulfonate is valued for its dual hydrophilic and hydrophobic characteristics, enabling diverse applications in both scientific and commercial fields.
Formula:C15H33NO3S
InChI:InChI=1/C15H33NO3S/c1-4-5-6-7-8-9-10-11-13-16(2,3)14-12-15-20(17,18)19/h4-15H2,1-3H3
InChI key:WKALLSVICJPZTM-UHFFFAOYSA-N
SMILES:CCCCCCCCCC[N+](C)(C)CCC[S-](=O)(=O)=O
Found 8 products.