CAS 15164-44-0
:4-Iodobenzaldehyde
Description:
4-Iodobenzaldehyde, also known as para-iodobenzaldehyde, is an organic compound characterized by the presence of an aldehyde functional group (-CHO) attached to a benzene ring that has an iodine atom in the para position relative to the aldehyde group. Its molecular formula is C7H6I, and it has a molecular weight that reflects the presence of iodine, which contributes to its unique properties. This compound typically appears as a pale yellow to brown solid and is known for its aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. 4-Iodobenzaldehyde is utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the iodine atom can enhance the compound's reactivity and influence its electronic properties, making it a valuable intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H5IO
InChI:InChI=1/C7H5IO/c8-7-3-1-6(5-9)2-4-7/h1-5H
SMILES:c1cc(ccc1C=O)I
Synonyms:- Benzaldehyde, 4-iodo-
- Nsc 84301
- Benzaldehyde of iodine
- P-Iodobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Iodobenzaldehyde, 98+%
CAS:4-Iodobenzaldehyde is used in synthesis of 4-[2-(trimethylsilyl)ethynyl]benzaldehyde, 5,15-dimesityl-10-(3-[2-(trimethylsilyl)ethynyi]phenyl}-20-(4-iodophenyl)porphyrin, and 5,15-dimesityl-10-[3,5-bis{2-[4-(N,N?-difluoroboryl-1,9-dimethyidipyrrin-5-yl)-phenyl]ethynyl}phenyl]-20-(4-iodophenyl)porphyrFormula:C7H5IOPurity:98+%Color and Shape:White to cream to yellow to brown, Crystals or powder or crystalline powder or fused solidMolecular weight:232.024-Iodobenzaldehyde
CAS:4-IodobenzaldehydeFormula:C7H5IOPurity:97%Color and Shape: light yellow crystalline solidMolecular weight:232.02g/mol4-Iodobenzaldehyde
CAS:Formula:C7H5IOPurity:>96.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:232.024-Iodobenzaldehyde
CAS:4-Iodobenzaldehyde is a chemical compound with the molecular formula C6H5IO. It is an aromatic compound that can be used in cancer therapy. 4-Iodobenzaldehyde reacts with trifluoroacetic acid to form an intramolecular hydrogen, which is detected using a low-energy monomer and high detection sensitivity. 4-Iodobenzaldehyde has two phenyl substituents and a serine protease functional group, which are required for its interaction with other molecules. The presence of these functional groups allows analytical methods to be used to identify 4-iodobenzaldehyde in various samples. Using analytical methods, it can be determined that 4-iodobenzaldehyde interacts with an acceptor molecule at the reaction vessel thermally or by irradiation.Formula:C7H5IOPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:232.02 g/mol4-Iodobenzaldehyde
CAS:Formula:C7H5IOPurity:98%Color and Shape:Crystalline PowderMolecular weight:232.02






