CAS 151666-08-9
:3-PHENOXYPIPERIDINE
Description:
3-Phenoxypiperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. The phenoxy group, derived from phenol, is attached to the third position of the piperidine ring, contributing to its unique properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. 3-Phenoxypiperidine is of interest in medicinal chemistry due to its potential applications in drug development, particularly as a pharmacological agent. Its structure allows for interactions with various biological targets, making it a candidate for further research in therapeutic contexts. Additionally, the presence of the phenoxy group can influence the compound's lipophilicity and bioavailability. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential hazards associated with its use. Overall, 3-phenoxypiperidine exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h1-3,5-6,11-12H,4,7-9H2
SMILES:c1ccc(cc1)OC1CCCNC1
Synonyms:- Piperidine, 3-Phenoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Phenoxypiperidine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H15NOPurity:97%Color and Shape:White or clear colorless, Fused solid or liquidMolecular weight:177.25

