CAS 1517-82-4: (-)-(1R)-menthyl (S)-toluene-4-sulfinate
Description:(-)-(1R)-menthyl (S)-toluene-4-sulfinate, with the CAS number 1517-82-4, is a chiral sulfonate ester derived from menthol and toluene-4-sulfonic acid. This compound exhibits characteristics typical of sulfonate esters, including good solubility in organic solvents and potential reactivity in nucleophilic substitution reactions. The presence of the menthyl group imparts a degree of stereochemistry, making it useful in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. The sulfonate moiety enhances the compound's ability to act as a leaving group, facilitating reactions such as alkylation or acylation. Additionally, due to its chiral nature, it may exhibit specific interactions in biological systems, making it of interest in pharmaceutical applications. The compound is typically handled with standard laboratory safety precautions, as with many organic chemicals, and its stability under various conditions is generally favorable, although specific storage conditions may be recommended to maintain its integrity.
Formula:C17H26O2S
InChI:InChI=1/C17H26O2S/c1-12(2)16-10-7-14(4)11-17(16)19-20(18)15-8-5-13(3)6-9-15/h5-6,8-9,12,14,16-17H,7,10-11H2,1-4H3/t14-,16+,17-,20?/m1/s1
- Synonyms:
- ()-(1R)-Menthyl (S)-p-toluenesulfinate
- (1R,2S,5R)-()-Menthyl (S)-p-toluenesulfinate
- (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl 4-methylbenzenesulfinate
