CAS 151775-20-1

S(-)-1-(9-FLUORENYL)ETHANOL

Description:

S(-)-1-(9-Fluorenyl)ethanol is an organic compound characterized by its chiral structure, featuring a fluorenyl group attached to an ethanol moiety. This compound is notable for its stereochemistry, specifically the S configuration, which influences its reactivity and interactions in various chemical environments. It is typically used in organic synthesis and as a chiral auxiliary in asymmetric synthesis, aiding in the production of enantiomerically pure compounds. The presence of the fluorenyl group contributes to its stability and potential applications in pharmaceuticals and materials science. Additionally, this compound may exhibit unique optical properties due to its chiral nature, making it of interest in studies related to chirality and its effects on biological systems. As with many organic compounds, safety precautions should be observed when handling S(-)-1-(9-Fluorenyl)ethanol, including proper storage and disposal methods to mitigate any potential hazards.

Formula: C₁₅H₁₄O

InChI: InChI=1/C15H14O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15-16H,1H3/t10-/m0/s1

SMILES: C[C@@H](C1c2ccccc2c2ccccc12)O

Synonyms:

• (1S)-1-(9H-fluoren-9-yl)ethanol

(S)-1-(9-Fluorenyl) Ethanol

CAS: 151775-20-1

Formula: C₁₅H₁₄O

Molecular weight: 210.28

Ref: 4Z-A-233014

(-)-1-(9-Fluorenyl)ethanol

Controlled Product

CAS: 151775-20-1

Formula: C₁₅H₁₄O

Color and Shape: Neat

Molecular weight: 210.271

Ref: TR-F647655