CAS 1518-54-3
:Isosaccharinic acid
Description:
Isosaccharinic acid is an organic compound that is classified as a sugar acid, specifically derived from the degradation of cellulose and hemicellulose. It is a white, crystalline solid that is soluble in water, reflecting its polar nature due to the presence of multiple hydroxyl (-OH) groups. The compound is known for its role in various biochemical processes and its potential applications in biochemistry and environmental science, particularly in the context of biomass conversion and the study of lignocellulosic materials. Isosaccharinic acid can exist in different isomeric forms, which may exhibit varying chemical properties and reactivity. It is also characterized by its ability to chelate metal ions, which can influence its behavior in biological systems and environmental contexts. Additionally, it has been studied for its potential use in the production of biodegradable polymers and as a precursor in the synthesis of other organic compounds. Overall, isosaccharinic acid is significant in both natural processes and industrial applications.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-2-4(9)1-6(12,3-8)5(10)11/h4,7-9,12H,1-3H2,(H,10,11)/t4-,6-/m0/s1
InChI key:InChIKey=SGOVJIDEXZEOTB-NJGYIYPDSA-N
SMILES:[C@@](C[C@@H](CO)O)(C(O)=O)(CO)O
Synonyms:- (2S,4S)-2,4,5-Trihydroxy-2-(hydroxymethyl)pentanoic acid
- 3-Deoxy-2-C-(hydroxymethyl)-<span class="text-smallcaps">D</span>-erythro-pentonic acid
- <span class="text-smallcaps">D</span>-erythro-Pentonic acid, 3-deoxy-2-C-(hydroxymethyl)-
- <span class="text-smallcaps">D</span>-gluco-Isosaccharinic acid
- Isosaccharinic acid
- pentonic acid, 3-deoxy-2-C-(hydroxymethyl)-
- α-<span class="text-smallcaps">D</span>-Glucoisosaccharinic acid
- α-<span class="text-smallcaps">D</span>-Isosaccharinic acid
- α-Glucoisosaccharinic acid
- α-Isosaccharinic acid
- α-D-Isosaccharinic acid
- D-gluco-Isosaccharinic acid
- 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid
- D-erythro-Pentonic acid, 3-deoxy-2-C-(hydroxymethyl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isosaccharinic acid
CAS:Isosaccharinic acid is a bacterial strain that produces isosaccharinic acid as its main fatty acid. The thermodynamic data for the reaction mechanism of the conversion of glucose to isosaccharinic acid has been determined. Isosaccharinic acid formation is catalyzed by an enzyme called glycosyl-glycerate dehydrogenase, which converts glycerate to 3-hydroxypropanoic acid and then to 3-oxopropanoate before it undergoes decarboxylation and reduction to form isosaccharinic acid. Radionuclides such as TcO4 are used in chemical ionization mass spectrometry for the detection of this compound in samples. Neutral pH, high activation energies, and low binding constants are all factors that affect the stability of this molecule.
Formula:C6H12O6Purity:Min. 95%Molecular weight:180.16 g/mol

