CAS 1518-56-5
:3-deoxy-2-C-(hydroxymethyl)pentonic acid
Description:
3-Deoxy-2-C-(hydroxymethyl)pentonic acid, identified by its CAS number 1518-56-5, is a carbohydrate derivative characterized by its unique structural features. This compound is a pentonic acid, meaning it contains five carbon atoms and possesses a carboxylic acid functional group. The presence of a hydroxymethyl group at the second carbon position contributes to its reactivity and potential biological activity. As a deoxy sugar, it lacks an oxygen atom typically found in the corresponding sugar, which can influence its metabolic pathways and interactions with biological systems. The compound is likely to exhibit properties typical of organic acids, such as solubility in water and the ability to participate in acid-base reactions. Its structural characteristics may also allow it to engage in hydrogen bonding, affecting its physical properties and interactions with other molecules. Overall, 3-deoxy-2-C-(hydroxymethyl)pentonic acid is of interest in biochemical research, particularly in the study of sugar metabolism and related enzymatic processes.
Formula:C6H12O6
InChI:InChI=1/C6H12O6/c7-2-4(9)1-6(12,3-8)5(10)11/h4,7-9,12H,1-3H2,(H,10,11)
SMILES:C(C(CO)O)C(CO)(C(=O)O)O
Synonyms:- pentonic acid, 3-deoxy-2-C-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
