CAS 15185-59-8
:m-Bromocinnamaldehyde
Description:
m-Bromocinnamaldehyde, with the CAS number 15185-59-8, is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and an aldehyde functional group. It is a derivative of cinnamaldehyde, where the bromine substituent is located at the meta position relative to the aldehyde group on the benzene ring. This compound typically appears as a yellowish to brownish liquid or solid, depending on its purity and form. It is known for its distinctive aromatic odor and is often used in organic synthesis and as a building block in the preparation of various pharmaceuticals and agrochemicals. The presence of the bromine atom enhances its reactivity, making it useful in electrophilic substitution reactions. Additionally, m-Bromocinnamaldehyde exhibits potential biological activities, which may include antimicrobial and anti-inflammatory properties, although specific biological effects can vary based on concentration and context. Proper handling and storage are essential due to its reactive nature and potential health hazards associated with brominated compounds.
Formula:C9H7BrO
InChI:InChI=1/C9H7BrO/c10-9-5-1-3-8(7-9)4-2-6-11/h1-7H/b4-2+
Synonyms:- (2E)-3-(3-Bromophenyl)acrylaldehyde
- (2E)-3-(3-Bromophenyl)prop-2-enal
- (2E)-3-(3-Bromphenyl)prop-2-enal
- 2-propenal, 3-(3-bromophenyl)-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
