CAS 151864-97-0
:calonyctin A-2b
Description:
Calonyctin A-2b, with the CAS number 151864-97-0, is a chemical compound that belongs to a class of natural products known as alkaloids. It is derived from certain species of plants and exhibits a range of biological activities, including potential pharmacological effects. The compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its reactivity and interaction with biological systems. Calonyctin A-2b has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of oncology and neurology. Its specific mechanisms of action and therapeutic potential are subjects of ongoing research, as scientists explore its efficacy and safety profiles. Additionally, the compound's solubility, stability, and bioavailability are important factors that influence its practical applications in pharmaceuticals. Overall, calonyctin A-2b represents a fascinating area of study within natural product chemistry and drug discovery.
Formula:C43H74O20
InChI:InChI=1/C43H74O20/c1-18(2)25-16-14-12-10-9-11-13-15-17-26(45)59-37-34(60-39(53)19(3)20(4)44)29(48)23(7)56-42(37)61-35-30(49)24(8)57-43(62-36-32(51)28(47)22(6)55-41(36)58-25)38(35)63-40-33(52)31(50)27(46)21(5)54-40/h18-25,27-38,40-44,46-52H,9-17H2,1-8H3/t19?,20?,21-,22-,23-,24-,25?,27+,28-,29-,30-,31-,32+,33-,34+,35?,36-,37?,38+,40+,41+,42+,43?/m1/s1
Synonyms:- DC-2b
- Calonyctin A-2b
- (3S,5R,6R,7S,22R,24R,25S,26S,27R,31R,32R,33S)-6,25,26,32-tetrahydroxy-5,24,31-trimethyl-10-oxo-20-(propan-2-yl)-33-{[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.0~3,8~.0~22,27~]tritriacont-7-yl 3-hydroxy-2-methylbutanoate (non-preferred name)
- Tetradecanoic acid, 11-((O-6-deoxy-3-O-(3-hydroxy-2-methyl-1-oxobutyl)-beta-D-glucopyranosyl-(1-3)-O-(6-deoxy-alpha-L-mannopyranosyl-(1-2))-O-6-deoxy-beta-D-glucopyranosyl-(1-2)-6-deoxy-beta-D-glucopyranosyl)oxy)-, intramol 1,2'''-ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Calonyctin A-2b
CAS:Calonyctin A-2b is one of two components of calonyctin A.Formula:C43H74O20Color and Shape:SolidMolecular weight:911.045
