CAS 151882-81-4
:N,N′-[Methylenebis(4,1-phenyleneiminocarbonyl)]bis[4-methylbenzenesulfonamide]
Description:
N,N′-[Methylenebis(4,1-phenyleneiminocarbonyl)]bis[4-methylbenzenesulfonamide], with CAS number 151882-81-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features sulfonamide groups, which are known for their antibacterial properties, and imine linkages that contribute to its reactivity and potential applications in various chemical processes. The presence of methylene bridges and phenylene units suggests that it may exhibit interesting thermal and mechanical properties, making it suitable for use in polymer chemistry or as a potential ligand in coordination chemistry. Additionally, the sulfonamide moieties can enhance solubility in polar solvents, which is beneficial for various applications in pharmaceuticals and materials science. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Overall, this compound represents a versatile structure with potential utility in both industrial and research settings.
Formula:C29H28N4O6S2
InChI:InChI=1S/C29H28N4O6S2/c1-20-3-15-26(16-4-20)40(36,37)32-28(34)30-24-11-7-22(8-12-24)19-23-9-13-25(14-10-23)31-29(35)33-41(38,39)27-17-5-21(2)6-18-27/h3-18H,19H2,1-2H3,(H2,30,32,34)(H2,31,33,35)
InChI key:InChIKey=XVSRGZPKJKLORS-UHFFFAOYSA-N
SMILES:C(C1=CC=C(NC(NS(=O)(=O)C2=CC=C(C)C=C2)=O)C=C1)C3=CC=C(NC(NS(=O)(=O)C4=CC=C(C)C=C4)=O)C=C3
Synonyms:- 4,4′-Bis(p-toluenesulfonylaminocarbonylamino)diphenylmethane
- 4,4′-Bis(p-toluenesulfonylaminocarboxylamino)diphenylmethane
- 4,4′-Bis(p-tolylsulfonylureido)diphenylmethane
- N,N′-[Methylenebis(4,1-phenyleneiminocarbonyl)]bis[4-methylbenzenesulfonamide]
- Benzenesulfonamide, N,N′-[methylenebis(4,1-phenyleneiminocarbonyl)]bis[4-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
BTUM
CAS:<p>Applications BTUM is uesed as a dye developer for direct thermal paper.<br>References Takahashi, Y., et. al.: IS&T’s Int. Congr. Ad Non-impact print. Tech., 10, 349 (1994)<br></p>Formula:C29H28N4O6S2Color and Shape:NeatMolecular weight:592.69BTUM
CAS:<p>BTUM is a medicinal compound that acts as an analog of human kinases. It has been shown to have potent anticancer properties, inhibiting the growth and proliferation of cancer cells by inducing apoptosis and disrupting the cell cycle. BTUM works by binding to specific proteins in cancer cells, which are involved in the regulation of cell growth and division. This inhibitor prevents these proteins from functioning properly, leading to the suppression of tumor growth. BTUM has been extensively studied in Chinese medicine, where it has been used for its anti-cancer properties for many years. With its ability to target cancer cells specifically, BTUM is a promising candidate for the development of new cancer therapies.</p>Formula:C29H28N4O6S2Purity:Min. 95%Molecular weight:592.7 g/mol

