CAS 15190-08-6

(4-chlorophenyl)(dimethylamino)acetonitrile

Description:

(4-chlorophenyl)(dimethylamino)acetonitrile, with the CAS number 15190-08-6, is an organic compound characterized by its functional groups and structural features. It contains a chlorophenyl group, which contributes to its aromatic properties, and a dimethylamino group, indicating the presence of nitrogen with two methyl substituents. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its moderate polarity due to the presence of the nitrile group, which can engage in dipole-dipole interactions. The chlorophenyl moiety can enhance its reactivity and influence its biological activity, making it of interest in various chemical syntheses and potential pharmaceutical applications. Additionally, the compound may exhibit moderate solubility in organic solvents, while its stability can be affected by environmental conditions such as temperature and pH. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₁₀H₁₁ClN₂

InChI: InChI=1/C10H11ClN2/c1-13(2)10(7-12)8-3-5-9(11)6-4-8/h3-6,10H,1-2H3

SMILES: CN(C)C(C#N)c1ccc(cc1)Cl

Synonyms:

• Benzeneacetonitrile, 4-chloro-alpha-(dimethylamino)-
• (4-Chlorophenyl)(dimethylamino)acetonitrile

2-(4-Chlorophenyl)-2-(dimethylamino)acetonitrile

CAS: 15190-08-6

Formula: C₁₀H₁₁ClN₂

Molecular weight: 194.6607

Ref: IN-DA00AWWU

2-(4-Chlorophenyl)-2-(dimethylamino)acetonitrile

CAS: 15190-08-6

2-(4-Chlorophenyl)-2-(dimethylamino)acetonitrile

Purity: ≥95%

Molecular weight: 194.66g/mol

Ref: 54-OR300802

(4-Chlorophenyl)(dimethylamino)acetonitrile

CAS: 15190-08-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂

Purity: Min. 95%

Molecular weight: 194.66 g/mol

Ref: 3D-QAA19008