CAS 15191-36-3
:2-BROMO-4,6-DIMETHYLBENZENOL
Description:
2-Bromo-4,6-dimethylbenzenol, with the CAS number 15191-36-3, is an organic compound characterized by its aromatic structure, which includes a bromine substituent and two methyl groups on a benzene ring, along with a hydroxyl (-OH) group. This compound is a derivative of phenol, indicating that it possesses both aromatic and alcohol functional characteristics. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The methyl groups contribute to the compound's hydrophobic nature and influence its solubility in organic solvents. Additionally, the hydroxyl group enhances its polarity, allowing for hydrogen bonding, which can affect its boiling and melting points. 2-Bromo-4,6-dimethylbenzenol may be utilized in organic synthesis, pharmaceuticals, and as an intermediate in the production of other chemical compounds. Its specific properties, such as reactivity and stability, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.
Formula:C8H9BrO
InChI:InChI=1/C8H9BrO/c1-5-3-6(2)8(10)7(9)4-5/h3-4,10H,1-2H3
SMILES:Cc1cc(C)c(c(c1)Br)O
Synonyms:- 6-Bromo-2,4-dimethylphenol
- 2-Bromo-4,6-Dimethylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4,6-dimethylphenol
CAS:Formula:C8H9BrOPurity:97%Color and Shape:LiquidMolecular weight:201.06052-Bromo-4,6-dimethylphenol
CAS:2-Bromo-4,6-dimethylphenolFormula:C8H9BrOPurity:96%Color and Shape: clear. pale lemon/lime liquidMolecular weight:201.06g/mol2-Bromo-4,6-dimethylphenol
CAS:Formula:C8H9BrOPurity:95%Color and Shape:LiquidMolecular weight:201.0632-Bromo-4,6-dimethylphenol
CAS:2-Bromo-4,6-dimethylphenol is a reactive compound that has bromination as one of its mechanisms. Bromine reacts with 2-bromo-4,6-dimethylphenol to form 2,6-dibromophenol. The reaction between bromine and dienone occurs to form the isomer of brominated dienone. Dienones are compounds that contain two carbonyl groups and one double bond in the molecule.
Formula:C8H9BrOPurity:Min. 95%Molecular weight:201.06 g/mol



