CymitQuimica logo

CAS 151911-04-5

:

3-[14-benzyl-5-(cyclohexylmethyl)-11-(1H-indol-3-ylmethyl)-2-(2-methylpropyl)-6,9,12,15,19-pentaoxo-1,4,7,10,13,16-hexaazacyclononadecan-8-yl]propanamide

Description:
The chemical substance with the name "3-[14-benzyl-5-(cyclohexylmethyl)-11-(1H-indol-3-ylmethyl)-2-(2-methylpropyl)-6,9,12,15,19-pentaoxo-1,4,7,10,13,16-hexaazacyclononadecan-8-yl]propanamide" and CAS number "151911-04-5" is a complex organic compound characterized by its multi-functional structure, which includes a hexacyclic framework and various substituents such as indole and cyclohexyl groups. This compound likely exhibits significant biological activity due to its intricate arrangement of functional groups, which may interact with biological targets. The presence of multiple carbonyl (oxo) groups suggests potential reactivity and the ability to form hydrogen bonds, influencing its solubility and stability. Additionally, the amide functional group indicates potential for forming peptide-like interactions. Given its structural complexity, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or as a probe in biochemical research. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation for precise characterization.
Formula:C43H60N8O6
InChI:InChI=1/C43H60N8O6/c1-27(2)21-31-26-47-35(22-28-11-5-3-6-12-28)42(56)49-34(17-18-38(44)52)41(55)51-37(24-30-25-46-33-16-10-9-15-32(30)33)43(57)50-36(23-29-13-7-4-8-14-29)40(54)45-20-19-39(53)48-31/h4,7-10,13-16,25,27-28,31,34-37,46-47H,3,5-6,11-12,17-24,26H2,1-2H3,(H2,44,52)(H,45,54)(H,48,53)(H,49,56)(H,50,57)(H,51,55)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.