CAS 152-22-7
:Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride (1:1)
Description:
Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride (1:1), commonly known as triethylammonium hydroxide chloride, is a quaternary ammonium compound characterized by its triethylammonium cation and a hydroxyl group attached to the ethyl chain. This compound typically appears as a white crystalline solid or a colorless liquid, depending on its form and purity. It is soluble in water and polar organic solvents, making it useful in various chemical applications, including as a surfactant and in organic synthesis. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in hydrogen bonding and enhancing its solubility in aqueous environments. As a chloride salt, it dissociates in solution to release chloride ions, which can influence the ionic strength and conductivity of the solution. Safety data indicates that it should be handled with care, as it may cause irritation to skin and eyes. Overall, this compound is significant in both industrial and laboratory settings due to its unique properties and versatility.
Formula:C8H20NO·Cl
InChI:InChI=1S/C8H20NO.ClH/c1-4-9(5-2,6-3)7-8-10;/h10H,4-8H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=HABNQJVSCNCEQV-UHFFFAOYSA-M
SMILES:[N+](CCO)(CC)(CC)CC.[Cl-]
Synonyms:- (2-Hydroxyethyl)triethylammonium chloride
- Ammonium, (2-hydroxyethyl)triethyl-, chloride
- Ammonium, triethyl(2-hydroxyethyl)-, chloride
- Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride
- Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride (1:1)
- Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride (9CI)
- N,N,N-Triethyl-2-hydroxyethanaminium chloride
- N,N,N-triethyl-2-hydroxyethanaminium
- Nsc 513123
- Triethylcholine chloride
- Triethyl(2-hydroxyethyl)ammonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethanaminium, N,N,N-triethyl-2-hydroxy-, chloride (1:1)
CAS:Formula:C8H20ClNOPurity:95%Color and Shape:SolidMolecular weight:181.7035Triethyl(2-hydroxyethyl)azanium chloride
CAS:Triethyl(2-hydroxyethyl)azanium chloride is a hydroxylated derivative of azanium chloride that is used as an anticholinesterase agent. It is administered by injection and has been shown to decrease blood pressure in animals. This drug also prevents the bladder contraction and urinary tract spasms, which are caused by acetylcholine release. Triethyl(2-hydroxyethyl)azanium chloride also inhibits the corrosion of metals due to its ability to react with fatty acids and oils. The inhibition of muscle tissue contractions may be due to its effect on the acetylcholine system, which plays a critical role in muscle function.Formula:C8H20ClNOPurity:Min. 95%Molecular weight:181.7 g/mol

