CAS 1520-26-9
:2-Hydroxyphenylthiourea
Description:
2-Hydroxyphenylthiourea, with the CAS number 1520-26-9, is an organic compound characterized by the presence of a thiourea functional group and a hydroxyl group attached to a phenyl ring. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. Its molecular structure features a phenolic hydroxyl group, which can participate in hydrogen bonding, enhancing its solubility and reactivity. 2-Hydroxyphenylthiourea is known for its applications in various fields, including medicinal chemistry, where it may exhibit biological activity, and in analytical chemistry, where it can serve as a reagent for the detection of certain metal ions. The compound's properties, such as melting point and stability, can vary based on environmental conditions and the presence of other substances. As with many thiourea derivatives, it is essential to handle 2-hydroxyphenylthiourea with care due to potential toxicity and the need for proper safety protocols in laboratory settings.
Formula:C7H8N2OS
InChI:InChI=1/C7H8N2OS/c8-7(11)9-5-3-1-2-4-6(5)10/h1-4,10H,(H3,8,9,11)
SMILES:c1ccc(c(c1)NC(=N)S)O
Synonyms:- Nsc 4469
- Nsc 48639
- o-Hydroxyphenylthiourea
- Thiourea, (2-hydroxyphenyl)-
- 1-(2-Hydroxyphenyl)Thiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(2-Hydroxyphenyl)thiourea, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H8N2OSPurity:97%Color and Shape:White to cream to brown, Crystals or powder or crystalline powderMolecular weight:168.21
